Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Palladium, 5% on carbon, Type 87L, dry
CAS: 5-3-7440 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 5-3-7440 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Cesium hydroxide, 99.9%, (trace metal basis), for analysis, 50 wt% solution in water
CAS: 21351-79-1 Molecular Formula: CsHO Molecular Weight (g/mol): 149.91 MDL Number: MFCD00010964 InChI Key: HUCVOHYBFXVBRW-UHFFFAOYSA-M Synonym: cesium hydroxide,caesium hydroxide,cesium hydrate,csoh,cesium hydroxide cs oh,cesium hydroxide dimer,cesium hydoxide,cs.ho,caesium 1+ oh,cesium hydroxide solution PubChem CID: 62750 ChEBI: CHEBI:33988 IUPAC Name: cesium;hydroxide SMILES: [OH-].[Cs+]
| PubChem CID | 62750 |
|---|---|
| CAS | 21351-79-1 |
| Molecular Weight (g/mol) | 149.91 |
| ChEBI | CHEBI:33988 |
| MDL Number | MFCD00010964 |
| SMILES | [OH-].[Cs+] |
| Synonym | cesium hydroxide,caesium hydroxide,cesium hydrate,csoh,cesium hydroxide cs oh,cesium hydroxide dimer,cesium hydoxide,cs.ho,caesium 1+ oh,cesium hydroxide solution |
| IUPAC Name | cesium;hydroxide |
| InChI Key | HUCVOHYBFXVBRW-UHFFFAOYSA-M |
| Molecular Formula | CsHO |
Cobalt(II) nitrate hexahydrate, 99%, pure
CAS: 10026-22-9 Molecular Formula: CoH12N2O12 Molecular Weight (g/mol): 291.03 MDL Number: MFCD00149647 InChI Key: QGUAJWGNOXCYJF-UHFFFAOYSA-N Synonym: cobalt nitrate hexahydrate,cobalt ii nitrate hexahydrate,cobaltous nitrate hexahydrate,cobalt dinitrate hexahydrate,cobalt 2+ nitrate hexahydrate,cobaltous nitrate, hexahydrate,kobalt ii-nitrat-hexahydrat,nitric acid, cobalt 2+ salt, hexahydrate PubChem CID: 24821 ChEBI: CHEBI:86214 SMILES: O.O.O.O.O.O.[Co++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24821 |
|---|---|
| CAS | 10026-22-9 |
| Molecular Weight (g/mol) | 291.03 |
| ChEBI | CHEBI:86214 |
| MDL Number | MFCD00149647 |
| SMILES | O.O.O.O.O.O.[Co++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | cobalt nitrate hexahydrate,cobalt ii nitrate hexahydrate,cobaltous nitrate hexahydrate,cobalt dinitrate hexahydrate,cobalt 2+ nitrate hexahydrate,cobaltous nitrate, hexahydrate,kobalt ii-nitrat-hexahydrat,nitric acid, cobalt 2+ salt, hexahydrate |
| InChI Key | QGUAJWGNOXCYJF-UHFFFAOYSA-N |
| Molecular Formula | CoH12N2O12 |
Silver perchlorate hydrate, 99%
CAS: 14242-05-8 Molecular Formula: AgClO4 Molecular Weight (g/mol): 207.31 MDL Number: MFCD00149128 InChI Key: YDHABVNRCBNRNZ-UHFFFAOYSA-M Synonym: silver perchlorate hydrate,silver perchlorate monohydrate,silver perchlorite,silver perchloric acid,acmc-1brvv,ag.clo4.h2o,silver i perchlorate monohydrate,silver 1+ ion hydrate perchlorate,silver 1+ hydrate perchlorate PubChem CID: 15959344 SMILES: [Ag+].[O-][Cl](=O)(=O)=O
| PubChem CID | 15959344 |
|---|---|
| CAS | 14242-05-8 |
| Molecular Weight (g/mol) | 207.31 |
| MDL Number | MFCD00149128 |
| SMILES | [Ag+].[O-][Cl](=O)(=O)=O |
| Synonym | silver perchlorate hydrate,silver perchlorate monohydrate,silver perchlorite,silver perchloric acid,acmc-1brvv,ag.clo4.h2o,silver i perchlorate monohydrate,silver 1+ ion hydrate perchlorate,silver 1+ hydrate perchlorate |
| InChI Key | YDHABVNRCBNRNZ-UHFFFAOYSA-M |
| Molecular Formula | AgClO4 |
Ammonium iron(III) oxalate trihydrate, 98%, pure
CAS: 13268-42-3 Molecular Formula: C6H18FeN3O15 Molecular Weight (g/mol): 428.06 MDL Number: MFCD00150137 InChI Key: ARJSTCBPHIPXIJ-UHFFFAOYSA-K Synonym: Ammonium ferric oxalate IUPAC Name: triammonium hexaoxo-1,4,6,9,10,13-hexaoxa-5-ferraspiro[4.4⁵.4⁵]tridecane-5,5,5-tris(ylium) trihydrate SMILES: [NH4+].[NH4+].[NH4+].O.O.O.O=C1O[Fe+3]234(OC1=O)OC(=O)C(=O)O2.O=C(O3)C(=O)O4
| CAS | 13268-42-3 |
|---|---|
| Molecular Weight (g/mol) | 428.06 |
| MDL Number | MFCD00150137 |
| SMILES | [NH4+].[NH4+].[NH4+].O.O.O.O=C1O[Fe+3]234(OC1=O)OC(=O)C(=O)O2.O=C(O3)C(=O)O4 |
| Synonym | Ammonium ferric oxalate |
| IUPAC Name | triammonium hexaoxo-1,4,6,9,10,13-hexaoxa-5-ferraspiro[4.4⁵.4⁵]tridecane-5,5,5-tris(ylium) trihydrate |
| InChI Key | ARJSTCBPHIPXIJ-UHFFFAOYSA-K |
| Molecular Formula | C6H18FeN3O15 |
Potassium tetrachloroaurate(III), 98%
CAS: 13682-61-6 Molecular Formula: AuCl4K Molecular Weight (g/mol): 377.88 MDL Number: MFCD00043088 InChI Key: JMONCQYBAMKVQQ-UHFFFAOYSA-J Synonym: potassium tetrachloroaurate iii,potassium tetrachloroaurate,k aucl4,kaucl4 * 2h2o,potassium tetrachloridoaurate,potassium ion tetrachloroaurate,potassium tetrachloroaurate 1-,potassium tetrachloridoaurate 1-,potassium tetrachloridoaurate iii,potassium gold iii chloride PubChem CID: 11337898 ChEBI: CHEBI:51564 IUPAC Name: potassium;tetrachlorogold(1-) SMILES: Cl[Au-](Cl)(Cl)Cl.[K+]
| PubChem CID | 11337898 |
|---|---|
| CAS | 13682-61-6 |
| Molecular Weight (g/mol) | 377.88 |
| ChEBI | CHEBI:51564 |
| MDL Number | MFCD00043088 |
| SMILES | Cl[Au-](Cl)(Cl)Cl.[K+] |
| Synonym | potassium tetrachloroaurate iii,potassium tetrachloroaurate,k aucl4,kaucl4 * 2h2o,potassium tetrachloridoaurate,potassium ion tetrachloroaurate,potassium tetrachloroaurate 1-,potassium tetrachloridoaurate 1-,potassium tetrachloridoaurate iii,potassium gold iii chloride |
| IUPAC Name | potassium;tetrachlorogold(1-) |
| InChI Key | JMONCQYBAMKVQQ-UHFFFAOYSA-J |
| Molecular Formula | AuCl4K |
Ammonium cerium(IV) sulfate dihydrate, 95%, ACS reagent
CAS: 10378-47-9 Molecular Formula: H16CeN4O16S4·2H2O Molecular Weight (g/mol): 632.54 Synonym: Ceric ammonium sulfate
| CAS | 10378-47-9 |
|---|---|
| Molecular Weight (g/mol) | 632.54 |
| Synonym | Ceric ammonium sulfate |
| Molecular Formula | H16CeN4O16S4·2H2O |
Titanium(III) fluoride, 98%, Thermo Scientific™
CAS: 13470-08-1 Molecular Formula: F3Ti Molecular Weight (g/mol): 104.9 MDL Number: MFCD00042544
| CAS | 13470-08-1 |
|---|---|
| Molecular Weight (g/mol) | 104.9 |
| MDL Number | MFCD00042544 |
| Molecular Formula | F3Ti |
Sulfuryl chloride, 1.0M solution in dichloromethane, AcroSeal™
CAS: 7791-25-5 | Cl2O2S | 134.96 g/mol
| Linear Formula | SO2Cl2 |
|---|---|
| Molecular Weight (g/mol) | 134.96 |
| ChEBI | CHEBI:29291 |
| Chemical Name or Material | Sulfuryl chloride |
| SMILES | ClS(Cl)(=O)=O |
| Merck Index | 15, 9110 |
| InChI Key | YBBRCQOCSYXUOC-UHFFFAOYSA-N |
| Density | 1.3520g/mL |
| Appearance | Clear pale yellow solution |
| PubChem CID | 24648 |
| Name Note | 1.0M Solution in Dichloromethane |
| Concentration or Composition (by Analyte or Components) | 1M, exact strength on the certificate of analysis |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| MDL Number | MFCD00011451 |
| Health Hazard 2 | GHS H Statement Suspected of causing cancer. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. Toxic if inhaled. Reacts violently with water. |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | sulfuryl chloride,sulfonyl chloride,sulphuryl dichloride,sulphuryl chloride,sulfonyl dichloride,sulfuric dichloride,sulfuric oxychloride,sulfurylchlorid,caswell no. 816,sulfurylchloride |
| IUPAC Name | sulfuryl dichloride |
| Molecular Formula | Cl2O2S |
| EINECS Number | 232-245-6 |
| Formula Weight | 134.97 |
| Specific Gravity | 1.352 |
Nitrosonium hexafluorophosphate, 95%
CAS: 16921-91-8 Molecular Formula: F6NOP Molecular Weight (g/mol): 174.97 MDL Number: MFCD00040324 InChI Key: SAKPNYRUBHJGAR-UHFFFAOYSA-N Synonym: nitrosonium hexafluorophosphate,nitrilooxonium hexafluorophosphate,nopf6,nitrosyl hexafluorophosphate,nitrosonium hexafluorophosphat,nitrosylhexafluorophosphate,azanylidyneoxidanium hexafluorophosphate,hexafluoro-$l^ 5-phosphanuide; nitrosonium PubChem CID: 10910083 IUPAC Name: azanylidyneoxidanium;hexafluorophosphate SMILES: N#[O+].F[P-](F)(F)(F)(F)F
| PubChem CID | 10910083 |
|---|---|
| CAS | 16921-91-8 |
| Molecular Weight (g/mol) | 174.97 |
| MDL Number | MFCD00040324 |
| SMILES | N#[O+].F[P-](F)(F)(F)(F)F |
| Synonym | nitrosonium hexafluorophosphate,nitrilooxonium hexafluorophosphate,nopf6,nitrosyl hexafluorophosphate,nitrosonium hexafluorophosphat,nitrosylhexafluorophosphate,azanylidyneoxidanium hexafluorophosphate,hexafluoro-$l^ 5-phosphanuide; nitrosonium |
| IUPAC Name | azanylidyneoxidanium;hexafluorophosphate |
| InChI Key | SAKPNYRUBHJGAR-UHFFFAOYSA-N |
| Molecular Formula | F6NOP |
Sodium tetrachloroaurate hydrate, 98%
CAS: 29156-65-8 Molecular Formula: AuCl4Na Molecular Weight (g/mol): 361.76 MDL Number: MFCD00149161 InChI Key: IXPWAPCEBHEFOV-UHFFFAOYSA-J Synonym: sodium tetrachloroaurate iii hydrate,aucl4.na.h2o,sodium tetrachloroaurate 1--water 1/1/1 PubChem CID: 18410391 IUPAC Name: sodium;tetrachlorogold(1-);hydrate SMILES: [Na+].Cl[Au-](Cl)(Cl)Cl
| PubChem CID | 18410391 |
|---|---|
| CAS | 29156-65-8 |
| Molecular Weight (g/mol) | 361.76 |
| MDL Number | MFCD00149161 |
| SMILES | [Na+].Cl[Au-](Cl)(Cl)Cl |
| Synonym | sodium tetrachloroaurate iii hydrate,aucl4.na.h2o,sodium tetrachloroaurate 1--water 1/1/1 |
| IUPAC Name | sodium;tetrachlorogold(1-);hydrate |
| InChI Key | IXPWAPCEBHEFOV-UHFFFAOYSA-J |
| Molecular Formula | AuCl4Na |
Potassium fluoride, 99+%, for analysis, Thermo Scientific Chemicals
CAS: 7789-23-3 Molecular Formula: FK Molecular Weight (g/mol): 58.10 MDL Number: MFCD00011398 InChI Key: NROKBHXJSPEDAR-UHFFFAOYSA-M Synonym: potassium fluoride,potassiumfluoride,potassium fluoride kf,potassium fluorure,fluorure de potassium,potassium fluorure french,potassium fluoride on calcium fluoride,potassium fluoride, anhydrous,unii-9082wg1g3f,ccris 1568 PubChem CID: 522689 ChEBI: CHEBI:66872 IUPAC Name: potassium fluoride SMILES: [F-].[K+]
| PubChem CID | 522689 |
|---|---|
| CAS | 7789-23-3 |
| Molecular Weight (g/mol) | 58.10 |
| ChEBI | CHEBI:66872 |
| MDL Number | MFCD00011398 |
| SMILES | [F-].[K+] |
| Synonym | potassium fluoride,potassiumfluoride,potassium fluoride kf,potassium fluorure,fluorure de potassium,potassium fluorure french,potassium fluoride on calcium fluoride,potassium fluoride, anhydrous,unii-9082wg1g3f,ccris 1568 |
| IUPAC Name | potassium fluoride |
| InChI Key | NROKBHXJSPEDAR-UHFFFAOYSA-M |
| Molecular Formula | FK |
Silver acetate, 99%, pure
CAS: 563-63-3 Molecular Formula: C2H3AgO2 Molecular Weight (g/mol): 166.91 MDL Number: MFCD00012446 InChI Key: CQLFBEKRDQMJLZ-UHFFFAOYSA-M Synonym: silver acetate,silver i acetate,silver 1+ acetate,silver monoacetate,unii-19pps85f9h,acetic acid, silver 1+ salt,acetic acid silver salt,silver 1+ ion acetate,acetic acid, silver 1+ salt 1:1,silver acetate ag oac PubChem CID: 11246 IUPAC Name: silver;acetate SMILES: CC(=O)[O-].[Ag+]
| PubChem CID | 11246 |
|---|---|
| CAS | 563-63-3 |
| Molecular Weight (g/mol) | 166.91 |
| MDL Number | MFCD00012446 |
| SMILES | CC(=O)[O-].[Ag+] |
| Synonym | silver acetate,silver i acetate,silver 1+ acetate,silver monoacetate,unii-19pps85f9h,acetic acid, silver 1+ salt,acetic acid silver salt,silver 1+ ion acetate,acetic acid, silver 1+ salt 1:1,silver acetate ag oac |
| IUPAC Name | silver;acetate |
| InChI Key | CQLFBEKRDQMJLZ-UHFFFAOYSA-M |
| Molecular Formula | C2H3AgO2 |
Sodium orthovanadate, 99.9% (metals basis)
CAS: 13721-39-6 Molecular Formula: Na3O4V Molecular Weight (g/mol): 183.907 MDL Number: MFCD00003511 InChI Key: IHIXIJGXTJIKRB-UHFFFAOYSA-N Synonym: sodium orthovanadate,trisodium vanadate,sodium o-vanadate,sodium pervanadate,sodium vanadate ortho,trisodium tetraoxovanadate,sodium tetraoxovanadate 3-,vanadic acid, trisodium salt,trisodium orthovanadate,vanadic acid h3vo4 , sodium salt PubChem CID: 61671 ChEBI: CHEBI:35607 IUPAC Name: trisodium;trioxido(oxo)vanadium SMILES: [O-][V](=O)([O-])[O-].[Na+].[Na+].[Na+]
| PubChem CID | 61671 |
|---|---|
| CAS | 13721-39-6 |
| Molecular Weight (g/mol) | 183.907 |
| ChEBI | CHEBI:35607 |
| MDL Number | MFCD00003511 |
| SMILES | [O-][V](=O)([O-])[O-].[Na+].[Na+].[Na+] |
| Synonym | sodium orthovanadate,trisodium vanadate,sodium o-vanadate,sodium pervanadate,sodium vanadate ortho,trisodium tetraoxovanadate,sodium tetraoxovanadate 3-,vanadic acid, trisodium salt,trisodium orthovanadate,vanadic acid h3vo4 , sodium salt |
| IUPAC Name | trisodium;trioxido(oxo)vanadium |
| InChI Key | IHIXIJGXTJIKRB-UHFFFAOYSA-N |
| Molecular Formula | Na3O4V |
Calcium phosphate, dibasic, 97%, pure, anhydrous
CAS: 7757-93-9 Molecular Formula: CaHO4P Molecular Weight (g/mol): 136.06 MDL Number: MFCD00010909 InChI Key: FUFJGUQYACFECW-UHFFFAOYSA-L Synonym: calcium hydrogen phosphate,calcium hydrogenphosphate,calcium phosphate dibasic,calcium phosphate, dibasic,biofos,fujicalin s,dicafos an,dibasic calcium phosphate,monocalcium acid phosphate,phosphoric acid, calcium salt 1:1 PubChem CID: 24441 ChEBI: CHEBI:32596 IUPAC Name: calcium;hydrogen phosphate SMILES: [Ca++].OP([O-])([O-])=O
| PubChem CID | 24441 |
|---|---|
| CAS | 7757-93-9 |
| Molecular Weight (g/mol) | 136.06 |
| ChEBI | CHEBI:32596 |
| MDL Number | MFCD00010909 |
| SMILES | [Ca++].OP([O-])([O-])=O |
| Synonym | calcium hydrogen phosphate,calcium hydrogenphosphate,calcium phosphate dibasic,calcium phosphate, dibasic,biofos,fujicalin s,dicafos an,dibasic calcium phosphate,monocalcium acid phosphate,phosphoric acid, calcium salt 1:1 |
| IUPAC Name | calcium;hydrogen phosphate |
| InChI Key | FUFJGUQYACFECW-UHFFFAOYSA-L |
| Molecular Formula | CaHO4P |